C11H20O7 — CID 90347658
(4R,5R)-4-hydroxy-2,5-dimethyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 90347658) has the molecular formula C11H20O7 and a molecular weight of 264.27 g/mol. Its IUPAC name is (4R,5R)-4-hydroxy-2,5-dimethyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (4R,5R)-4-hydroxy-2,5-dimethyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 90347658 |
| Molecular Formula | C11H20O7 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (4R,5R)-4-hydroxy-2,5-dimethyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | C[C@H]1C([C@H](O)[C@H](O)CO)OC(C)(C(=O)O)C[C@H]1O |
| InChI | InChI=1S/C11H20O7/c1-5-6(13)3-11(2,10(16)17)18-9(5)8(15)7(14)4-12/h5-9,12-15H,3-4H2,1-2H3,(H,16,17)/t5-,6-,7-,8-,9?,11?/m1/s1 |
| InChIKey | CHRMDNTVXWMZLG-ZEAPDONSSA-N |
| XLogP | -1.67 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |