C17H29N3O8 — CID 163412737
(2R,4R,5R)-2-[(3-tert-butyltriazol-4-yl)methoxy]-4-hydroxy-5-methyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 163412737) has the molecular formula C17H29N3O8 and a molecular weight of 403.43 g/mol. Its IUPAC name is (2R,4R,5R)-2-[(3-tert-butyltriazol-4-yl)methoxy]-4-hydroxy-5-methyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2R,4R,5R)-2-[(3-tert-butyltriazol-4-yl)methoxy]-4-hydroxy-5-methyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 163412737 |
| Molecular Formula | C17H29N3O8 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (2R,4R,5R)-2-[(3-tert-butyltriazol-4-yl)methoxy]-4-hydroxy-5-methyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | C[C@H]1C([C@H](O)[C@H](O)CO)O[C@@](OCc2cnnn2C(C)(C)C)(C(=O)O)C[C@H]1O |
| InChI | InChI=1S/C17H29N3O8/c1-9-11(22)5-17(15(25)26,28-14(9)13(24)12(23)7-21)27-8-10-6-18-19-20(10)16(2,3)4/h6,9,11-14,21-24H,5,7-8H2,1-4H3,(H,25,26)/t9-,11-,12-,13-,14?,17-/m1/s1 |
| InChIKey | FWHCRFPYRWKKIE-JOGVGFFWSA-N |
| XLogP | -1.17 |
| TPSA | 167.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |