C33H46O11 — CID 126764300
methyl 2-[[(3S,4S,6R)-3,4-dimethyl-5,6-bis(phenylmethoxy)oxan-2-yl]methoxy]-4-hydroxy-5-methyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (PubChem CID 126764300) has the molecular formula C33H46O11 and a molecular weight of 618.72 g/mol. Its IUPAC name is methyl 2-[[(3S,4S,6R)-3,4-dimethyl-5,6-bis(phenylmethoxy)oxan-2-yl]methoxy]-4-hydroxy-5-methyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate.
| Compound Name | methyl 2-[[(3S,4S,6R)-3,4-dimethyl-5,6-bis(phenylmethoxy)oxan-2-yl]methoxy]-4-hydroxy-5-methyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 126764300 |
| Molecular Formula | C33H46O11 |
| Molecular Weight | 618.72 g/mol |
| Exact Mass | 618.30 |
| IUPAC Name | methyl 2-[[(3S,4S,6R)-3,4-dimethyl-5,6-bis(phenylmethoxy)oxan-2-yl]methoxy]-4-hydroxy-5-methyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)C1(OCC2O[C@@H](OCc3ccccc3)C(OCc3ccccc3)[C@@H](C)[C@@H]2C)CC(O)C(C)C([C@H](O)[C@H](O)CO)O1 |
| InChI | InChI=1S/C33H46O11/c1-20-21(2)30(40-17-23-11-7-5-8-12-23)31(41-18-24-13-9-6-10-14-24)43-27(20)19-42-33(32(38)39-4)15-25(35)22(3)29(44-33)28(37)26(36)16-34/h5-14,20-22,25-31,34-37H,15-19H2,1-4H3/t20-,21-,22?,25?,26+,27?,28+,29?,30?,31+,33?/m0/s1 |
| InChIKey | GFGVFXFNNXIAJK-XYKFIBIYSA-N |
| XLogP | 2.17 |
| TPSA | 153.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.72 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |