C31H50O7 — CID 158577213
methyl (2R,4R,5R)-2-[[(3S,4S,6S)-6-methoxy-3,4-dimethyl-5-phenylmethoxyoxan-2-yl]methoxy]-4,5-dimethyl-6-[(2R,3R)-3-methylpentan-2-yl]oxane-2-carboxylate (PubChem CID 158577213) has the molecular formula C31H50O7 and a molecular weight of 534.73 g/mol. Its IUPAC name is methyl (2R,4R,5R)-2-[[(3S,4S,6S)-6-methoxy-3,4-dimethyl-5-phenylmethoxyoxan-2-yl]methoxy]-4,5-dimethyl-6-[(2R,3R)-3-methylpentan-2-yl]oxane-2-carboxylate.
| Compound Name | methyl (2R,4R,5R)-2-[[(3S,4S,6S)-6-methoxy-3,4-dimethyl-5-phenylmethoxyoxan-2-yl]methoxy]-4,5-dimethyl-6-[(2R,3R)-3-methylpentan-2-yl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 158577213 |
| Molecular Formula | C31H50O7 |
| Molecular Weight | 534.73 g/mol |
| Exact Mass | 534.36 |
| IUPAC Name | methyl (2R,4R,5R)-2-[[(3S,4S,6S)-6-methoxy-3,4-dimethyl-5-phenylmethoxyoxan-2-yl]methoxy]-4,5-dimethyl-6-[(2R,3R)-3-methylpentan-2-yl]oxane-2-carboxylate |
| SMILES | CC[C@@H](C)[C@@H](C)C1O[C@@](OCC2O[C@H](OC)C(OCc3ccccc3)[C@@H](C)[C@@H]2C)(C(=O)OC)C[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C31H50O7/c1-10-19(2)21(4)27-22(5)20(3)16-31(38-27,30(32)34-9)36-18-26-23(6)24(7)28(29(33-8)37-26)35-17-25-14-12-11-13-15-25/h11-15,19-24,26-29H,10,16-18H2,1-9H3/t19-,20-,21-,22-,23+,24+,26?,27?,28?,29+,31-/m1/s1 |
| InChIKey | HSUPVGUQZHISGO-HGEBSNDSSA-N |
| XLogP | 5.84 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.73 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |