C19H27NO9 — CID 25209240
methyl (2S,4S,5R,6R)-5-acetamido-2-hydroxy-4-phenylmethoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (PubChem CID 25209240) has the molecular formula C19H27NO9 and a molecular weight of 413.42 g/mol. Its IUPAC name is methyl (2S,4S,5R,6R)-5-acetamido-2-hydroxy-4-phenylmethoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,4S,5R,6R)-5-acetamido-2-hydroxy-4-phenylmethoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 25209240 |
| Molecular Formula | C19H27NO9 |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | methyl (2S,4S,5R,6R)-5-acetamido-2-hydroxy-4-phenylmethoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(O)C[C@H](OCc2ccccc2)[C@@H](NC(C)=O)[C@H]([C@H](O)[C@H](O)CO)O1 |
| InChI | InChI=1S/C19H27NO9/c1-11(22)20-15-14(28-10-12-6-4-3-5-7-12)8-19(26,18(25)27-2)29-17(15)16(24)13(23)9-21/h3-7,13-17,21,23-24,26H,8-10H2,1-2H3,(H,20,22)/t13-,14+,15-,16-,17-,19+/m1/s1 |
| InChIKey | YARXGQAJRHQCOX-QCQTWIRCSA-N |
| XLogP | -1.56 |
| TPSA | 154.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |