C22H33NO10 — CID 176908963
methyl (2R,4S,5R,6R)-4-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylmethoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (PubChem CID 176908963) has the molecular formula C22H33NO10 and a molecular weight of 471.50 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-4-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylmethoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-4-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylmethoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 176908963 |
| Molecular Formula | C22H33NO10 |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | methyl (2R,4S,5R,6R)-4-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylmethoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(OCc2ccccc2)C[C@H](O)[C@@H](NC(=O)OC(C)(C)C)[C@H]([C@H](O)[C@H](O)CO)O1 |
| InChI | InChI=1S/C22H33NO10/c1-21(2,3)33-20(29)23-16-14(25)10-22(19(28)30-4,31-12-13-8-6-5-7-9-13)32-18(16)17(27)15(26)11-24/h5-9,14-18,24-27H,10-12H2,1-4H3,(H,23,29)/t14-,15+,16+,17+,18+,22+/m0/s1 |
| InChIKey | XTCUYNFWTQMTIK-FURYSJITSA-N |
| XLogP | -0.17 |
| TPSA | 164.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |