C21H30N2O11 — CID 10600971
ethyl (4S,5R,6R)-2,4-dihydroxy-5-[[2-(phenylmethoxycarbonylamino)acetyl]amino]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (PubChem CID 10600971) has the molecular formula C21H30N2O11 and a molecular weight of 486.47 g/mol. Its IUPAC name is ethyl (4S,5R,6R)-2,4-dihydroxy-5-[[2-(phenylmethoxycarbonylamino)acetyl]amino]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate.
| Compound Name | ethyl (4S,5R,6R)-2,4-dihydroxy-5-[[2-(phenylmethoxycarbonylamino)acetyl]amino]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 10600971 |
| Molecular Formula | C21H30N2O11 |
| Molecular Weight | 486.47 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | ethyl (4S,5R,6R)-2,4-dihydroxy-5-[[2-(phenylmethoxycarbonylamino)acetyl]amino]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| SMILES | CCOC(=O)C1(O)C[C@H](O)[C@@H](NC(=O)CNC(=O)OCc2ccccc2)[C@H]([C@H](O)[C@H](O)CO)O1 |
| InChI | InChI=1S/C21H30N2O11/c1-2-32-19(29)21(31)8-13(25)16(18(34-21)17(28)14(26)10-24)23-15(27)9-22-20(30)33-11-12-6-4-3-5-7-12/h3-7,13-14,16-18,24-26,28,31H,2,8-11H2,1H3,(H,22,30)(H,23,27)/t13-,14+,16+,17+,18+,21?/m0/s1 |
| InChIKey | PFFHKOUZTFZFKG-FKVSMUIOSA-N |
| XLogP | -2.49 |
| TPSA | 204.11 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.47 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |