C18H25NO10 — CID 135070479
(2S,4R,5R)-2,4-dihydroxy-5-[(2-phenylmethoxyacetyl)amino]-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid (PubChem CID 135070479) has the molecular formula C18H25NO10 and a molecular weight of 415.40 g/mol. Its IUPAC name is (2S,4R,5R)-2,4-dihydroxy-5-[(2-phenylmethoxyacetyl)amino]-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid.
| Compound Name | (2S,4R,5R)-2,4-dihydroxy-5-[(2-phenylmethoxyacetyl)amino]-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 135070479 |
| Molecular Formula | C18H25NO10 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | (2S,4R,5R)-2,4-dihydroxy-5-[(2-phenylmethoxyacetyl)amino]-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid |
| SMILES | O=C(COCc1ccccc1)N[C@H]1C(C(O)C(O)CO)O[C@](O)(C(=O)O)C[C@H]1O |
| InChI | InChI=1S/C18H25NO10/c20-7-12(22)15(24)16-14(11(21)6-18(27,29-16)17(25)26)19-13(23)9-28-8-10-4-2-1-3-5-10/h1-5,11-12,14-16,20-22,24,27H,6-9H2,(H,19,23)(H,25,26)/t11-,12?,14-,15?,16?,18+/m1/s1 |
| InChIKey | XNLGORKOEBWOBL-NPWVBSTOSA-N |
| XLogP | -2.67 |
| TPSA | 186.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |