C17H26N2O6 — CID 176972994
1-[(2R,4S,5R,6R)-5-amino-6-[(1R,2R)-3-amino-1,2-dihydroxypropyl]-4-hydroxy-2-phenylmethoxyoxan-2-yl]ethanone (PubChem CID 176972994) has the molecular formula C17H26N2O6 and a molecular weight of 354.40 g/mol. Its IUPAC name is 1-[(2R,4S,5R,6R)-5-amino-6-[(1R,2R)-3-amino-1,2-dihydroxypropyl]-4-hydroxy-2-phenylmethoxyoxan-2-yl]ethanone.
| Compound Name | 1-[(2R,4S,5R,6R)-5-amino-6-[(1R,2R)-3-amino-1,2-dihydroxypropyl]-4-hydroxy-2-phenylmethoxyoxan-2-yl]ethanone |
|---|---|
| PubChem CID | 176972994 |
| Molecular Formula | C17H26N2O6 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-[(2R,4S,5R,6R)-5-amino-6-[(1R,2R)-3-amino-1,2-dihydroxypropyl]-4-hydroxy-2-phenylmethoxyoxan-2-yl]ethanone |
| SMILES | CC(=O)[C@@]1(OCc2ccccc2)C[C@H](O)[C@@H](N)[C@H]([C@H](O)[C@H](O)CN)O1 |
| InChI | InChI=1S/C17H26N2O6/c1-10(20)17(24-9-11-5-3-2-4-6-11)7-12(21)14(19)16(25-17)15(23)13(22)8-18/h2-6,12-16,21-23H,7-9,18-19H2,1H3/t12-,13+,14+,15+,16+,17+/m0/s1 |
| InChIKey | CEOGFHUACSQCLX-XXJXLTMMSA-N |
| XLogP | -1.35 |
| TPSA | 148.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |