C16H21NaO12S — CID 23682600
sodium [(2S)-1-[(2S,3R,4R,6R)-6-carboxy-3,4-dihydroxy-6-phenylmethoxyoxan-2-yl]-1,3-dihydroxypropan-2-yl] sulfate (PubChem CID 23682600) has the molecular formula C16H21NaO12S and a molecular weight of 460.39 g/mol. Its IUPAC name is sodium [(2S)-1-[(2S,3R,4R,6R)-6-carboxy-3,4-dihydroxy-6-phenylmethoxyoxan-2-yl]-1,3-dihydroxypropan-2-yl] sulfate.
| Compound Name | sodium [(2S)-1-[(2S,3R,4R,6R)-6-carboxy-3,4-dihydroxy-6-phenylmethoxyoxan-2-yl]-1,3-dihydroxypropan-2-yl] sulfate |
|---|---|
| PubChem CID | 23682600 |
| Molecular Formula | C16H21NaO12S |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | sodium [(2S)-1-[(2S,3R,4R,6R)-6-carboxy-3,4-dihydroxy-6-phenylmethoxyoxan-2-yl]-1,3-dihydroxypropan-2-yl] sulfate |
| SMILES | O=C(O)[C@@]1(OCc2ccccc2)C[C@@H](O)[C@@H](O)[C@@H](C(O)[C@H](CO)OS(=O)(=O)[O-])O1.[Na+] |
| InChI | InChI=1S/C16H22O12S.Na/c17-7-11(28-29(23,24)25)13(20)14-12(19)10(18)6-16(27-14,15(21)22)26-8-9-4-2-1-3-5-9;/h1-5,10-14,17-20H,6-8H2,(H,21,22)(H,23,24,25);/q;+1/p-1/t10-,11+,12-,13?,14+,16-;/m1./s1 |
| InChIKey | GPEKTQRRSJGQML-AOQDTNEKSA-M |
| XLogP | -5.30 |
| TPSA | 203.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | -5.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|