C14H27NO12 — CID 91855219
(2R,4R,5R,6R)-2-[(2R,3S,4R,5S)-5-amino-2,3,4,6-tetrahydroxyhexoxy]-6-[(1R)-1,2-dihydroxyethyl]-4,5-dihydroxyoxane-2-carboxylic acid (PubChem CID 91855219) has the molecular formula C14H27NO12 and a molecular weight of 401.37 g/mol. Its IUPAC name is (2R,4R,5R,6R)-2-[(2R,3S,4R,5S)-5-amino-2,3,4,6-tetrahydroxyhexoxy]-6-[(1R)-1,2-dihydroxyethyl]-4,5-dihydroxyoxane-2-carboxylic acid.
| Compound Name | (2R,4R,5R,6R)-2-[(2R,3S,4R,5S)-5-amino-2,3,4,6-tetrahydroxyhexoxy]-6-[(1R)-1,2-dihydroxyethyl]-4,5-dihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 91855219 |
| Molecular Formula | C14H27NO12 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | (2R,4R,5R,6R)-2-[(2R,3S,4R,5S)-5-amino-2,3,4,6-tetrahydroxyhexoxy]-6-[(1R)-1,2-dihydroxyethyl]-4,5-dihydroxyoxane-2-carboxylic acid |
| SMILES | N[C@@H](CO)[C@@H](O)[C@H](O)[C@H](O)CO[C@]1(C(=O)O)C[C@@H](O)[C@@H](O)[C@@H]([C@H](O)CO)O1 |
| InChI | InChI=1S/C14H27NO12/c15-5(2-16)9(21)10(22)8(20)4-26-14(13(24)25)1-6(18)11(23)12(27-14)7(19)3-17/h5-12,16-23H,1-4,15H2,(H,24,25)/t5-,6+,7+,8+,9+,10+,11+,12+,14+/m0/s1 |
| InChIKey | OOWWOEYNAWKMJB-CJKREDSBSA-N |
| XLogP | -5.95 |
| TPSA | 243.62 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | -5.95 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |