C11H18NNaO9 — CID 118691047
sodium (2R,4S,5R,6R)-2-acetyloxy-5-amino-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (PubChem CID 118691047) has the molecular formula C11H18NNaO9 and a molecular weight of 331.25 g/mol. Its IUPAC name is sodium (2R,4S,5R,6R)-2-acetyloxy-5-amino-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate.
| Compound Name | sodium (2R,4S,5R,6R)-2-acetyloxy-5-amino-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 118691047 |
| Molecular Formula | C11H18NNaO9 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | sodium (2R,4S,5R,6R)-2-acetyloxy-5-amino-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| SMILES | CC(=O)O[C@@]1(C(=O)[O-])C[C@H](O)[C@@H](N)[C@H]([C@H](O)[C@H](O)CO)O1.[Na+] |
| InChI | InChI=1S/C11H19NO9.Na/c1-4(14)20-11(10(18)19)2-5(15)7(12)9(21-11)8(17)6(16)3-13;/h5-9,13,15-17H,2-3,12H2,1H3,(H,18,19);/q;+1/p-1/t5-,6+,7+,8+,9+,11-;/m0./s1 |
| InChIKey | VFWMCLANZBGGNS-BKSOAOGQSA-M |
| XLogP | -7.81 |
| TPSA | 182.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | -7.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |