C17H23N2NaO12 — CID 169444747
sodium;(2S,4S,5R,6R)-5-acetamido-4-hydroxy-2-(4-nitrophenoxy)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate;hydrate (PubChem CID 169444747) has the molecular formula C17H23N2NaO12 and a molecular weight of 470.36 g/mol. Its IUPAC name is sodium;(2S,4S,5R,6R)-5-acetamido-4-hydroxy-2-(4-nitrophenoxy)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate;hydrate.
| Compound Name | sodium;(2S,4S,5R,6R)-5-acetamido-4-hydroxy-2-(4-nitrophenoxy)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate;hydrate |
|---|---|
| PubChem CID | 169444747 |
| Molecular Formula | C17H23N2NaO12 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | sodium;(2S,4S,5R,6R)-5-acetamido-4-hydroxy-2-(4-nitrophenoxy)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate;hydrate |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)O[C@@](Oc2ccc([N+](=O)[O-])cc2)(C(=O)[O-])C[C@@H]1O.O.[Na+] |
| InChI | InChI=1S/C17H22N2O11.Na.H2O/c1-8(21)18-13-11(22)6-17(16(25)26,30-15(13)14(24)12(23)7-20)29-10-4-2-9(3-5-10)19(27)28;;/h2-5,11-15,20,22-24H,6-7H2,1H3,(H,18,21)(H,25,26);;1H2/q;+1;/p-1/t11-,12+,13+,14+,15+,17+;;/m0../s1 |
| InChIKey | FTHBIZTUXKHVQZ-NNOFHBBZSA-M |
| XLogP | -7.03 |
| TPSA | 243.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | -7.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|