C17H21N2NaO11 — CID 102330520
sodium N-[(2R,3R,4S,6S)-6-carboxy-4-hydroxy-6-(4-nitrophenoxy)-2-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-3-yl]ethanimidate (PubChem CID 102330520) has the molecular formula C17H21N2NaO11 and a molecular weight of 452.35 g/mol. Its IUPAC name is sodium N-[(2R,3R,4S,6S)-6-carboxy-4-hydroxy-6-(4-nitrophenoxy)-2-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-3-yl]ethanimidate.
| Compound Name | sodium N-[(2R,3R,4S,6S)-6-carboxy-4-hydroxy-6-(4-nitrophenoxy)-2-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-3-yl]ethanimidate |
|---|---|
| PubChem CID | 102330520 |
| Molecular Formula | C17H21N2NaO11 |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | sodium N-[(2R,3R,4S,6S)-6-carboxy-4-hydroxy-6-(4-nitrophenoxy)-2-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-3-yl]ethanimidate |
| SMILES | C/C([O-])=N\[C@H]1[C@H]([C@H](O)[C@H](O)CO)O[C@@](Oc2ccc([N+](=O)[O-])cc2)(C(=O)O)C[C@@H]1O.[Na+] |
| InChI | InChI=1S/C17H22N2O11.Na/c1-8(21)18-13-11(22)6-17(16(25)26,30-15(13)14(24)12(23)7-20)29-10-4-2-9(3-5-10)19(27)28;/h2-5,11-15,20,22-24H,6-7H2,1H3,(H,18,21)(H,25,26);/q;+1/p-1/t11-,12+,13+,14+,15+,17+;/m0./s1 |
| InChIKey | UVBQAEXLKFXKPM-MLFSYFRJSA-M |
| XLogP | -5.23 |
| TPSA | 215.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | -5.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|