C15H20N2O10 — CID 174778648
(4S,5R,6R)-5-amino-4-hydroxy-2-(4-nitrophenoxy)-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid (PubChem CID 174778648) has the molecular formula C15H20N2O10 and a molecular weight of 388.33 g/mol. Its IUPAC name is (4S,5R,6R)-5-amino-4-hydroxy-2-(4-nitrophenoxy)-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid.
| Compound Name | (4S,5R,6R)-5-amino-4-hydroxy-2-(4-nitrophenoxy)-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 174778648 |
| Molecular Formula | C15H20N2O10 |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (4S,5R,6R)-5-amino-4-hydroxy-2-(4-nitrophenoxy)-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid |
| SMILES | N[C@@H]1[C@@H](O)CC(Oc2ccc([N+](=O)[O-])cc2)(C(=O)O)O[C@H]1C(O)C(O)CO |
| InChI | InChI=1S/C15H20N2O10/c16-11-9(19)5-15(14(22)23,27-13(11)12(21)10(20)6-18)26-8-3-1-7(2-4-8)17(24)25/h1-4,9-13,18-21H,5-6,16H2,(H,22,23)/t9-,10?,11+,12?,13+,15?/m0/s1 |
| InChIKey | MNFUIXMCMLCNBW-DOSZEEPNSA-N |
| XLogP | -2.05 |
| TPSA | 205.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|