C17H20N2O11 — CID 10836267
N-[(1S,3R,4S,5S,8R)-8-hydroxy-1-(4-nitrophenoxy)-7-oxo-3-[(1R,2R)-1,2,3-trihydroxypropyl]-2,6-dioxabicyclo[3.2.1]octan-4-yl]acetamide (PubChem CID 10836267) has the molecular formula C17H20N2O11 and a molecular weight of 428.35 g/mol. Its IUPAC name is N-[(1S,3R,4S,5S,8R)-8-hydroxy-1-(4-nitrophenoxy)-7-oxo-3-[(1R,2R)-1,2,3-trihydroxypropyl]-2,6-dioxabicyclo[3.2.1]octan-4-yl]acetamide.
| Compound Name | N-[(1S,3R,4S,5S,8R)-8-hydroxy-1-(4-nitrophenoxy)-7-oxo-3-[(1R,2R)-1,2,3-trihydroxypropyl]-2,6-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
|---|---|
| PubChem CID | 10836267 |
| Molecular Formula | C17H20N2O11 |
| Molecular Weight | 428.35 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | N-[(1S,3R,4S,5S,8R)-8-hydroxy-1-(4-nitrophenoxy)-7-oxo-3-[(1R,2R)-1,2,3-trihydroxypropyl]-2,6-dioxabicyclo[3.2.1]octan-4-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)O[C@@]2(Oc3ccc([N+](=O)[O-])cc3)C(=O)O[C@@H]1[C@H]2O |
| InChI | InChI=1S/C17H20N2O11/c1-7(21)18-11-13(12(23)10(22)6-20)30-17(15(24)14(11)28-16(17)25)29-9-4-2-8(3-5-9)19(26)27/h2-5,10-15,20,22-24H,6H2,1H3,(H,18,21)/t10-,11+,12-,13-,14+,15-,17-/m1/s1 |
| InChIKey | ADWJSTHZOQYGDK-WVPOIJIQSA-N |
| XLogP | -2.43 |
| TPSA | 197.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.35 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|