C16H25NO11 — CID 118928142
methyl 2-acetyloxy-5-amino-6-[(1S,2R)-1,2-diacetyloxy-3-hydroxypropyl]-4-hydroxyoxane-2-carboxylate (PubChem CID 118928142) has the molecular formula C16H25NO11 and a molecular weight of 407.37 g/mol. Its IUPAC name is methyl 2-acetyloxy-5-amino-6-[(1S,2R)-1,2-diacetyloxy-3-hydroxypropyl]-4-hydroxyoxane-2-carboxylate.
| Compound Name | methyl 2-acetyloxy-5-amino-6-[(1S,2R)-1,2-diacetyloxy-3-hydroxypropyl]-4-hydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 118928142 |
| Molecular Formula | C16H25NO11 |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | methyl 2-acetyloxy-5-amino-6-[(1S,2R)-1,2-diacetyloxy-3-hydroxypropyl]-4-hydroxyoxane-2-carboxylate |
| SMILES | COC(=O)C1(OC(C)=O)CC(O)C(N)C([C@H](OC(C)=O)[C@@H](CO)OC(C)=O)O1 |
| InChI | InChI=1S/C16H25NO11/c1-7(19)25-11(6-18)13(26-8(2)20)14-12(17)10(22)5-16(28-14,15(23)24-4)27-9(3)21/h10-14,18,22H,5-6,17H2,1-4H3/t10?,11-,12?,13-,14?,16?/m1/s1 |
| InChIKey | QCJFKURBOCAYRU-JRDYGXCNSA-N |
| XLogP | -2.25 |
| TPSA | 180.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|