C26H34O14 — CID 123340357
methyl 2,4-diacetyloxy-5-(2-oxohex-5-ynyl)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 123340357) has the molecular formula C26H34O14 and a molecular weight of 570.54 g/mol. Its IUPAC name is methyl 2,4-diacetyloxy-5-(2-oxohex-5-ynyl)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl 2,4-diacetyloxy-5-(2-oxohex-5-ynyl)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 123340357 |
| Molecular Formula | C26H34O14 |
| Molecular Weight | 570.54 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | methyl 2,4-diacetyloxy-5-(2-oxohex-5-ynyl)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | C#CCCC(=O)CC1C(OC(C)=O)CC(OC(C)=O)(C(=O)OC)OC1[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C26H34O14/c1-8-9-10-19(32)11-20-21(36-15(3)28)12-26(25(33)34-7,39-18(6)31)40-23(20)24(38-17(5)30)22(37-16(4)29)13-35-14(2)27/h1,20-24H,9-13H2,2-7H3/t20?,21?,22-,23?,24-,26?/m1/s1 |
| InChIKey | SMJUUCLRJIJJQJ-ZUIZPCKMSA-N |
| XLogP | 0.55 |
| TPSA | 184.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.54 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|