C28H34O15 — CID 14332701
benzyl 2,4,5-triacetyloxy-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate (PubChem CID 14332701) has the molecular formula C28H34O15 and a molecular weight of 610.57 g/mol. Its IUPAC name is benzyl 2,4,5-triacetyloxy-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate.
| Compound Name | benzyl 2,4,5-triacetyloxy-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 14332701 |
| Molecular Formula | C28H34O15 |
| Molecular Weight | 610.57 g/mol |
| Exact Mass | 610.19 |
| IUPAC Name | benzyl 2,4,5-triacetyloxy-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C1OC(OC(C)=O)(C(=O)OCc2ccccc2)CC(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C28H34O15/c1-15(29)36-14-23(39-17(3)31)25(41-19(5)33)26-24(40-18(4)32)22(38-16(2)30)12-28(43-26,42-20(6)34)27(35)37-13-21-10-8-7-9-11-21/h7-11,22-26H,12-14H2,1-6H3 |
| InChIKey | RZVGQQWOYQRPNX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 193.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.57 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|