C25H33NO12 — CID 10579066
methyl (2R,4S,5R,6R)-4-acetyloxy-5-amino-2-phenylmethoxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 10579066) has the molecular formula C25H33NO12 and a molecular weight of 539.53 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-4-acetyloxy-5-amino-2-phenylmethoxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-4-acetyloxy-5-amino-2-phenylmethoxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 10579066 |
| Molecular Formula | C25H33NO12 |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | methyl (2R,4S,5R,6R)-4-acetyloxy-5-amino-2-phenylmethoxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(OCc2ccccc2)C[C@H](OC(C)=O)[C@@H](N)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C25H33NO12/c1-14(27)33-13-20(36-16(3)29)22(37-17(4)30)23-21(26)19(35-15(2)28)11-25(38-23,24(31)32-5)34-12-18-9-7-6-8-10-18/h6-10,19-23H,11-13,26H2,1-5H3/t19-,20+,21+,22+,23+,25+/m0/s1 |
| InChIKey | FBZCBPJBAGQGKD-QULIQSTESA-N |
| XLogP | 0.55 |
| TPSA | 175.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|