C25H31NO11 — CID 102527769
methyl 3-acetamido-6-phenylmethoxy-2-(1,2,3-triacetyloxypropyl)-2,3-dihydropyran-6-carboxylate (PubChem CID 102527769) has the molecular formula C25H31NO11 and a molecular weight of 521.52 g/mol. Its IUPAC name is methyl 3-acetamido-6-phenylmethoxy-2-(1,2,3-triacetyloxypropyl)-2,3-dihydropyran-6-carboxylate.
| Compound Name | methyl 3-acetamido-6-phenylmethoxy-2-(1,2,3-triacetyloxypropyl)-2,3-dihydropyran-6-carboxylate |
|---|---|
| PubChem CID | 102527769 |
| Molecular Formula | C25H31NO11 |
| Molecular Weight | 521.52 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | methyl 3-acetamido-6-phenylmethoxy-2-(1,2,3-triacetyloxypropyl)-2,3-dihydropyran-6-carboxylate |
| SMILES | COC(=O)C1(OCc2ccccc2)C=CC(NC(C)=O)C(C(OC(C)=O)C(COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C25H31NO11/c1-15(27)26-20-11-12-25(24(31)32-5,34-13-19-9-7-6-8-10-19)37-22(20)23(36-18(4)30)21(35-17(3)29)14-33-16(2)28/h6-12,20-23H,13-14H2,1-5H3,(H,26,27) |
| InChIKey | IIDUUVIUPJONGN-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.52 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|