C20H26F3NO10S — CID 71764309
methyl (2R,3R,6S)-6-ethylsulfanyl-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3-[(2,2,2-trifluoroacetyl)amino]-2,3-dihydropyran-6-carboxylate (PubChem CID 71764309) has the molecular formula C20H26F3NO10S and a molecular weight of 529.49 g/mol. Its IUPAC name is methyl (2R,3R,6S)-6-ethylsulfanyl-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3-[(2,2,2-trifluoroacetyl)amino]-2,3-dihydropyran-6-carboxylate.
| Compound Name | methyl (2R,3R,6S)-6-ethylsulfanyl-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3-[(2,2,2-trifluoroacetyl)amino]-2,3-dihydropyran-6-carboxylate |
|---|---|
| PubChem CID | 71764309 |
| Molecular Formula | C20H26F3NO10S |
| Molecular Weight | 529.49 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | methyl (2R,3R,6S)-6-ethylsulfanyl-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3-[(2,2,2-trifluoroacetyl)amino]-2,3-dihydropyran-6-carboxylate |
| SMILES | CCS[C@]1(C(=O)OC)C=C[C@@H](NC(=O)C(F)(F)F)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C20H26F3NO10S/c1-6-35-19(18(29)30-5)8-7-13(24-17(28)20(21,22)23)15(34-19)16(33-12(4)27)14(32-11(3)26)9-31-10(2)25/h7-8,13-16H,6,9H2,1-5H3,(H,24,28)/t13-,14-,15-,16-,19+/m1/s1 |
| InChIKey | MGWSNBRRDZWIPX-HLTONANMSA-N |
| XLogP | 1.04 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.49 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|