C28H43NO11 — CID 134950242
methyl (2R,3R,6S)-3-acetamido-6-(4-tert-butyl-1-hydroxycyclohexyl)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-2,3-dihydropyran-6-carboxylate (PubChem CID 134950242) has the molecular formula C28H43NO11 and a molecular weight of 569.65 g/mol. Its IUPAC name is methyl (2R,3R,6S)-3-acetamido-6-(4-tert-butyl-1-hydroxycyclohexyl)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-2,3-dihydropyran-6-carboxylate.
| Compound Name | methyl (2R,3R,6S)-3-acetamido-6-(4-tert-butyl-1-hydroxycyclohexyl)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-2,3-dihydropyran-6-carboxylate |
|---|---|
| PubChem CID | 134950242 |
| Molecular Formula | C28H43NO11 |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | methyl (2R,3R,6S)-3-acetamido-6-(4-tert-butyl-1-hydroxycyclohexyl)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-2,3-dihydropyran-6-carboxylate |
| SMILES | COC(=O)[C@@]1(C2(O)CCC(C(C)(C)C)CC2)C=C[C@@H](NC(C)=O)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C28H43NO11/c1-16(30)29-21-11-14-28(25(34)36-8,27(35)12-9-20(10-13-27)26(5,6)7)40-23(21)24(39-19(4)33)22(38-18(3)32)15-37-17(2)31/h11,14,20-24,35H,9-10,12-13,15H2,1-8H3,(H,29,30)/t20?,21-,22-,23-,24-,27?,28-/m1/s1 |
| InChIKey | MGCUWOYYKMLPFS-FQZYCBLMSA-N |
| XLogP | 1.75 |
| TPSA | 163.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|