C19H26O12 — CID 88860639
methyl (1S,3R,4S,5R,6S)-5-acetyloxy-4-methyl-3-[(1S,2R)-1,2,3-triacetyloxypropyl]-2,7-dioxabicyclo[4.1.0]heptane-1-carboxylate (PubChem CID 88860639) has the molecular formula C19H26O12 and a molecular weight of 446.41 g/mol. Its IUPAC name is methyl (1S,3R,4S,5R,6S)-5-acetyloxy-4-methyl-3-[(1S,2R)-1,2,3-triacetyloxypropyl]-2,7-dioxabicyclo[4.1.0]heptane-1-carboxylate.
| Compound Name | methyl (1S,3R,4S,5R,6S)-5-acetyloxy-4-methyl-3-[(1S,2R)-1,2,3-triacetyloxypropyl]-2,7-dioxabicyclo[4.1.0]heptane-1-carboxylate |
|---|---|
| PubChem CID | 88860639 |
| Molecular Formula | C19H26O12 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | methyl (1S,3R,4S,5R,6S)-5-acetyloxy-4-methyl-3-[(1S,2R)-1,2,3-triacetyloxypropyl]-2,7-dioxabicyclo[4.1.0]heptane-1-carboxylate |
| SMILES | COC(=O)[C@@]12O[C@@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)[C@H](C)[C@@H](OC(C)=O)[C@@H]1O2 |
| InChI | InChI=1S/C19H26O12/c1-8-14(16(29-12(5)23)13(27-10(3)21)7-26-9(2)20)30-19(18(24)25-6)17(31-19)15(8)28-11(4)22/h8,13-17H,7H2,1-6H3/t8-,13+,14+,15+,16+,17-,19+/m0/s1 |
| InChIKey | RYANYHBQDXMAHT-VQSOUNKISA-N |
| XLogP | -0.35 |
| TPSA | 153.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|