C20H30F2N2O10 — CID 134299910
methyl (2R)-5-acetamido-4-(ethylamino)-2,3-difluoro-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 134299910) has the molecular formula C20H30F2N2O10 and a molecular weight of 496.46 g/mol. Its IUPAC name is methyl (2R)-5-acetamido-4-(ethylamino)-2,3-difluoro-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R)-5-acetamido-4-(ethylamino)-2,3-difluoro-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 134299910 |
| Molecular Formula | C20H30F2N2O10 |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | methyl (2R)-5-acetamido-4-(ethylamino)-2,3-difluoro-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | CCNC1C(NC(C)=O)C([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O[C@@](F)(C(=O)OC)C1F |
| InChI | InChI=1S/C20H30F2N2O10/c1-7-23-15-14(24-9(2)25)17(34-20(22,18(15)21)19(29)30-6)16(33-12(5)28)13(32-11(4)27)8-31-10(3)26/h13-18,23H,7-8H2,1-6H3,(H,24,25)/t13-,14?,15?,16-,17?,18?,20-/m1/s1 |
| InChIKey | FAVXZTSYFHUWPQ-GMLCPXAMSA-N |
| XLogP | -0.53 |
| TPSA | 155.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|