C14H22F2N2O9 — CID 118736942
methyl (2R,3R,4R,5R,6R)-5-acetamido-4-amino-6-[(1R,2R)-1,2-dihydroxy-3-methoxycarbonyloxypropyl]-2,3-difluorooxane-2-carboxylate (PubChem CID 118736942) has the molecular formula C14H22F2N2O9 and a molecular weight of 400.33 g/mol. Its IUPAC name is methyl (2R,3R,4R,5R,6R)-5-acetamido-4-amino-6-[(1R,2R)-1,2-dihydroxy-3-methoxycarbonyloxypropyl]-2,3-difluorooxane-2-carboxylate.
| Compound Name | methyl (2R,3R,4R,5R,6R)-5-acetamido-4-amino-6-[(1R,2R)-1,2-dihydroxy-3-methoxycarbonyloxypropyl]-2,3-difluorooxane-2-carboxylate |
|---|---|
| PubChem CID | 118736942 |
| Molecular Formula | C14H22F2N2O9 |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | methyl (2R,3R,4R,5R,6R)-5-acetamido-4-amino-6-[(1R,2R)-1,2-dihydroxy-3-methoxycarbonyloxypropyl]-2,3-difluorooxane-2-carboxylate |
| SMILES | COC(=O)OC[C@@H](O)[C@@H](O)[C@@H]1O[C@@](F)(C(=O)OC)[C@H](F)[C@H](N)[C@H]1NC(C)=O |
| InChI | InChI=1S/C14H22F2N2O9/c1-5(19)18-8-7(17)11(15)14(16,12(22)24-2)27-10(8)9(21)6(20)4-26-13(23)25-3/h6-11,20-21H,4,17H2,1-3H3,(H,18,19)/t6-,7-,8-,9-,10-,11-,14-/m1/s1 |
| InChIKey | NWHJAMVGXQVFDE-ANINLJSHSA-N |
| XLogP | -2.10 |
| TPSA | 166.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |