C27H30F2N2O9 — CID 118736945
methyl (2R,3R,4R,5R,6R)-5-acetamido-4-amino-6-[(1R,2R)-3-(9H-fluoren-9-ylmethoxycarbonyloxy)-1,2-dihydroxypropyl]-2,3-difluorooxane-2-carboxylate (PubChem CID 118736945) has the molecular formula C27H30F2N2O9 and a molecular weight of 564.54 g/mol. Its IUPAC name is methyl (2R,3R,4R,5R,6R)-5-acetamido-4-amino-6-[(1R,2R)-3-(9H-fluoren-9-ylmethoxycarbonyloxy)-1,2-dihydroxypropyl]-2,3-difluorooxane-2-carboxylate.
| Compound Name | methyl (2R,3R,4R,5R,6R)-5-acetamido-4-amino-6-[(1R,2R)-3-(9H-fluoren-9-ylmethoxycarbonyloxy)-1,2-dihydroxypropyl]-2,3-difluorooxane-2-carboxylate |
|---|---|
| PubChem CID | 118736945 |
| Molecular Formula | C27H30F2N2O9 |
| Molecular Weight | 564.54 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | methyl (2R,3R,4R,5R,6R)-5-acetamido-4-amino-6-[(1R,2R)-3-(9H-fluoren-9-ylmethoxycarbonyloxy)-1,2-dihydroxypropyl]-2,3-difluorooxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(F)O[C@@H]([C@H](O)[C@H](O)COC(=O)OCC2c3ccccc3-c3ccccc32)[C@H](NC(C)=O)[C@@H](N)[C@H]1F |
| InChI | InChI=1S/C27H30F2N2O9/c1-13(32)31-21-20(30)24(28)27(29,25(35)37-2)40-23(21)22(34)19(33)12-39-26(36)38-11-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,18-24,33-34H,11-12,30H2,1-2H3,(H,31,32)/t19-,20-,21-,22-,23-,24-,27-/m1/s1 |
| InChIKey | ORVUFHRGWLNGLR-OFXYDROCSA-N |
| XLogP | 1.08 |
| TPSA | 166.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.54 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |