C23H18O4 — CID 89246029
(4-acetylphenyl) 9H-fluoren-9-ylmethyl carbonate (PubChem CID 89246029) has the molecular formula C23H18O4 and a molecular weight of 358.39 g/mol. Its IUPAC name is (4-acetylphenyl) 9H-fluoren-9-ylmethyl carbonate.
| Compound Name | (4-acetylphenyl) 9H-fluoren-9-ylmethyl carbonate |
|---|---|
| PubChem CID | 89246029 |
| Molecular Formula | C23H18O4 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | (4-acetylphenyl) 9H-fluoren-9-ylmethyl carbonate |
| SMILES | CC(=O)c1ccc(OC(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C23H18O4/c1-15(24)16-10-12-17(13-11-16)27-23(25)26-14-22-20-8-4-2-6-18(20)19-7-3-5-9-21(19)22/h2-13,22H,14H2,1H3 |
| InChIKey | ILMJTXUSXIUCPH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|