C41H39NO5 — CID 72510660
9H-fluoren-9-ylmethyl [4-[1-[4-[2-(2-hydroxyethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenyl] carbonate (PubChem CID 72510660) has the molecular formula C41H39NO5 and a molecular weight of 625.77 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl [4-[1-[4-[2-(2-hydroxyethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenyl] carbonate.
| Compound Name | 9H-fluoren-9-ylmethyl [4-[1-[4-[2-(2-hydroxyethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenyl] carbonate |
|---|---|
| PubChem CID | 72510660 |
| Molecular Formula | C41H39NO5 |
| Molecular Weight | 625.77 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | 9H-fluoren-9-ylmethyl [4-[1-[4-[2-(2-hydroxyethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenyl] carbonate |
| SMILES | CCC(=C(c1ccc(OCCNCCO)cc1)c1ccc(OC(=O)OCC2c3ccccc3-c3ccccc32)cc1)c1ccccc1 |
| InChI | InChI=1S/C41H39NO5/c1-2-34(29-10-4-3-5-11-29)40(30-16-20-32(21-17-30)45-27-25-42-24-26-43)31-18-22-33(23-19-31)47-41(44)46-28-39-37-14-8-6-12-35(37)36-13-7-9-15-38(36)39/h3-23,39,42-43H,2,24-28H2,1H3 |
| InChIKey | ZRIVGEKBDSEFRF-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.77 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|