C33H37BrN2O13 — CID 177495532
methyl (2R,3S,4S,5R,6R)-5-acetamido-3-bromo-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxy-6-[(1R,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 177495532) has the molecular formula C33H37BrN2O13 and a molecular weight of 749.56 g/mol. Its IUPAC name is methyl (2R,3S,4S,5R,6R)-5-acetamido-3-bromo-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxy-6-[(1R,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,3S,4S,5R,6R)-5-acetamido-3-bromo-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxy-6-[(1R,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 177495532 |
| Molecular Formula | C33H37BrN2O13 |
| Molecular Weight | 749.56 g/mol |
| Exact Mass | 748.15 |
| IUPAC Name | methyl (2R,3S,4S,5R,6R)-5-acetamido-3-bromo-4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxy-6-[(1R,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(O)O[C@@H]([C@@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)[C@H](NC(C)=O)[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)[C@@H]1Br |
| InChI | InChI=1S/C33H37BrN2O13/c1-16(37)35-26-27(36-32(42)46-14-24-22-12-8-6-10-20(22)21-11-7-9-13-23(21)24)30(34)33(43,31(41)44-5)49-29(26)28(48-19(4)40)25(47-18(3)39)15-45-17(2)38/h6-13,24-30,43H,14-15H2,1-5H3,(H,35,37)(H,36,42)/t25-,26-,27+,28+,29-,30+,33+/m1/s1 |
| InChIKey | UEKRNYIWSHKAMX-RAFYZUQZSA-N |
| XLogP | 1.85 |
| TPSA | 202.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.56 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|