C17H27NO10 — CID 101350653
methyl (2S,4S,5R,6R)-5-acetamido-6-[(1R,2R)-1,2-dihydroxy-3-pent-4-enoyloxypropyl]-2,4-dihydroxyoxane-2-carboxylate (PubChem CID 101350653) has the molecular formula C17H27NO10 and a molecular weight of 405.40 g/mol. Its IUPAC name is methyl (2S,4S,5R,6R)-5-acetamido-6-[(1R,2R)-1,2-dihydroxy-3-pent-4-enoyloxypropyl]-2,4-dihydroxyoxane-2-carboxylate.
| Compound Name | methyl (2S,4S,5R,6R)-5-acetamido-6-[(1R,2R)-1,2-dihydroxy-3-pent-4-enoyloxypropyl]-2,4-dihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 101350653 |
| Molecular Formula | C17H27NO10 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | methyl (2S,4S,5R,6R)-5-acetamido-6-[(1R,2R)-1,2-dihydroxy-3-pent-4-enoyloxypropyl]-2,4-dihydroxyoxane-2-carboxylate |
| SMILES | C=CCCC(=O)OC[C@@H](O)[C@@H](O)[C@@H]1O[C@](O)(C(=O)OC)C[C@H](O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C17H27NO10/c1-4-5-6-12(22)27-8-11(21)14(23)15-13(18-9(2)19)10(20)7-17(25,28-15)16(24)26-3/h4,10-11,13-15,20-21,23,25H,1,5-8H2,2-3H3,(H,18,19)/t10-,11+,13+,14+,15+,17-/m0/s1 |
| InChIKey | NPWPDAAWLZPNQX-BPOSEPGKSA-N |
| XLogP | -2.27 |
| TPSA | 171.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|