C13H22INO8 — CID 10297433
ethyl (2S,4S,5R)-5-acetamido-6-[(1R,2S)-1,2-dihydroxy-3-iodopropyl]-2,4-dihydroxyoxane-2-carboxylate (PubChem CID 10297433) has the molecular formula C13H22INO8 and a molecular weight of 447.22 g/mol. Its IUPAC name is ethyl (2S,4S,5R)-5-acetamido-6-[(1R,2S)-1,2-dihydroxy-3-iodopropyl]-2,4-dihydroxyoxane-2-carboxylate.
| Compound Name | ethyl (2S,4S,5R)-5-acetamido-6-[(1R,2S)-1,2-dihydroxy-3-iodopropyl]-2,4-dihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 10297433 |
| Molecular Formula | C13H22INO8 |
| Molecular Weight | 447.22 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | ethyl (2S,4S,5R)-5-acetamido-6-[(1R,2S)-1,2-dihydroxy-3-iodopropyl]-2,4-dihydroxyoxane-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(O)C[C@H](O)[C@@H](NC(C)=O)C([C@H](O)[C@H](O)CI)O1 |
| InChI | InChI=1S/C13H22INO8/c1-3-22-12(20)13(21)4-7(17)9(15-6(2)16)11(23-13)10(19)8(18)5-14/h7-11,17-19,21H,3-5H2,1-2H3,(H,15,16)/t7-,8+,9+,10+,11?,13-/m0/s1 |
| InChIKey | YACGIQUVBBOIQV-KKRQNTBLSA-N |
| XLogP | -1.95 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.22 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|