C16H25F5N2O7 — CID 118736922
5,5,5-trifluoropentyl (2R,3R,4R,5R,6R)-5-acetamido-4-amino-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (PubChem CID 118736922) has the molecular formula C16H25F5N2O7 and a molecular weight of 452.37 g/mol. Its IUPAC name is 5,5,5-trifluoropentyl (2R,3R,4R,5R,6R)-5-acetamido-4-amino-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate.
| Compound Name | 5,5,5-trifluoropentyl (2R,3R,4R,5R,6R)-5-acetamido-4-amino-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 118736922 |
| Molecular Formula | C16H25F5N2O7 |
| Molecular Weight | 452.37 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 5,5,5-trifluoropentyl (2R,3R,4R,5R,6R)-5-acetamido-4-amino-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| SMILES | CC(=O)N[C@@H]1[C@@H](N)[C@@H](F)[C@](F)(C(=O)OCCCCC(F)(F)F)O[C@H]1[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C16H25F5N2O7/c1-7(25)23-10-9(22)13(17)16(21,30-12(10)11(27)8(26)6-24)14(28)29-5-3-2-4-15(18,19)20/h8-13,24,26-27H,2-6,22H2,1H3,(H,23,25)/t8-,9-,10-,11-,12-,13-,16-/m1/s1 |
| InChIKey | FSEVELJDOKCTCD-CFQUAKNTSA-N |
| XLogP | -0.79 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.37 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|