C13H25F2N4O8P — CID 166677176
[(2S,3R,4R,5R,6R)-5-acetamido-4-(diaminomethylideneamino)-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-2-yl]-ethoxyphosphinic acid (PubChem CID 166677176) has the molecular formula C13H25F2N4O8P and a molecular weight of 434.33 g/mol. Its IUPAC name is [(2S,3R,4R,5R,6R)-5-acetamido-4-(diaminomethylideneamino)-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-2-yl]-ethoxyphosphinic acid.
| Compound Name | [(2S,3R,4R,5R,6R)-5-acetamido-4-(diaminomethylideneamino)-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-2-yl]-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 166677176 |
| Molecular Formula | C13H25F2N4O8P |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | [(2S,3R,4R,5R,6R)-5-acetamido-4-(diaminomethylideneamino)-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-2-yl]-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)[C@]1(F)O[C@@H]([C@H](O)[C@H](O)CO)[C@H](NC(C)=O)[C@@H](N=C(N)N)[C@H]1F |
| InChI | InChI=1S/C13H25F2N4O8P/c1-3-26-28(24,25)13(15)11(14)8(19-12(16)17)7(18-5(2)21)10(27-13)9(23)6(22)4-20/h6-11,20,22-23H,3-4H2,1-2H3,(H,18,21)(H,24,25)(H4,16,17,19)/t6-,7-,8-,9-,10-,11-,13-/m1/s1 |
| InChIKey | LJQNIQZDADTMPR-MENWFVNHSA-N |
| XLogP | -2.57 |
| TPSA | 209.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|