C15H22F2N4O8 — CID 118933907
(4R,5R,6R)-5-acetamido-2,3-difluoro-4-[5-(methoxymethyl)triazol-1-yl]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 118933907) has the molecular formula C15H22F2N4O8 and a molecular weight of 424.36 g/mol. Its IUPAC name is (4R,5R,6R)-5-acetamido-2,3-difluoro-4-[5-(methoxymethyl)triazol-1-yl]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (4R,5R,6R)-5-acetamido-2,3-difluoro-4-[5-(methoxymethyl)triazol-1-yl]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 118933907 |
| Molecular Formula | C15H22F2N4O8 |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | (4R,5R,6R)-5-acetamido-2,3-difluoro-4-[5-(methoxymethyl)triazol-1-yl]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | COCc1cnnn1[C@H]1C(F)C(F)(C(=O)O)O[C@@H]([C@H](O)[C@H](O)CO)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C15H22F2N4O8/c1-6(23)19-9-10(21-7(5-28-2)3-18-20-21)13(16)15(17,14(26)27)29-12(9)11(25)8(24)4-22/h3,8-13,22,24-25H,4-5H2,1-2H3,(H,19,23)(H,26,27)/t8-,9-,10-,11-,12-,13?,15?/m1/s1 |
| InChIKey | XLJDJYAYQLFNKZ-XVQKKSMCSA-N |
| XLogP | -2.33 |
| TPSA | 176.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |