C17H27F2N3O8 — CID 90360386
(2R,3S,5R)-5-acetamido-4-(1-aminoethenylamino)-6-[(1R,2R)-3-butanoyloxy-1,2-dihydroxypropyl]-2,3-difluorooxane-2-carboxylic acid (PubChem CID 90360386) has the molecular formula C17H27F2N3O8 and a molecular weight of 439.41 g/mol. Its IUPAC name is (2R,3S,5R)-5-acetamido-4-(1-aminoethenylamino)-6-[(1R,2R)-3-butanoyloxy-1,2-dihydroxypropyl]-2,3-difluorooxane-2-carboxylic acid.
| Compound Name | (2R,3S,5R)-5-acetamido-4-(1-aminoethenylamino)-6-[(1R,2R)-3-butanoyloxy-1,2-dihydroxypropyl]-2,3-difluorooxane-2-carboxylic acid |
|---|---|
| PubChem CID | 90360386 |
| Molecular Formula | C17H27F2N3O8 |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | (2R,3S,5R)-5-acetamido-4-(1-aminoethenylamino)-6-[(1R,2R)-3-butanoyloxy-1,2-dihydroxypropyl]-2,3-difluorooxane-2-carboxylic acid |
| SMILES | C=C(N)NC1[C@@H](NC(C)=O)C([C@H](O)[C@H](O)COC(=O)CCC)O[C@@](F)(C(=O)O)[C@H]1F |
| InChI | InChI=1S/C17H27F2N3O8/c1-4-5-10(25)29-6-9(24)13(26)14-11(22-8(3)23)12(21-7(2)20)15(18)17(19,30-14)16(27)28/h9,11-15,21,24,26H,2,4-6,20H2,1,3H3,(H,22,23)(H,27,28)/t9-,11-,12?,13-,14?,15+,17-/m1/s1 |
| InChIKey | USTIEZVWRDHCGB-RWWJRZDMSA-N |
| XLogP | -1.57 |
| TPSA | 180.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |