C28H37NO12S2 — CID 10985113
methyl (2R,3S,4R,5S,6R)-5-acetamido-4-acetyloxy-2-ethylsulfanyl-3-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 10985113) has the molecular formula C28H37NO12S2 and a molecular weight of 643.73 g/mol. Its IUPAC name is methyl (2R,3S,4R,5S,6R)-5-acetamido-4-acetyloxy-2-ethylsulfanyl-3-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,3S,4R,5S,6R)-5-acetamido-4-acetyloxy-2-ethylsulfanyl-3-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 10985113 |
| Molecular Formula | C28H37NO12S2 |
| Molecular Weight | 643.73 g/mol |
| Exact Mass | 643.18 |
| IUPAC Name | methyl (2R,3S,4R,5S,6R)-5-acetamido-4-acetyloxy-2-ethylsulfanyl-3-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | CCS[C@@]1(C(=O)OC)O[C@@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)[C@H](NC(C)=O)[C@@H](OC(C)=O)[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C28H37NO12S2/c1-8-42-28(27(35)36-7)26(43-20-12-10-9-11-13-20)25(40-19(6)34)22(29-15(2)30)24(41-28)23(39-18(5)33)21(38-17(4)32)14-37-16(3)31/h9-13,21-26H,8,14H2,1-7H3,(H,29,30)/t21-,22+,23-,24-,25-,26+,28+/m1/s1 |
| InChIKey | CBZNDOIJCAZHDR-ZPOMJJLZSA-N |
| XLogP | 2.03 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.73 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|