C28H35NO14S — CID 101171937
methyl (2R,4S,5R,6R)-4-acetyloxy-5-[(2-acetyloxyacetyl)amino]-2-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 101171937) has the molecular formula C28H35NO14S and a molecular weight of 641.65 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-4-acetyloxy-5-[(2-acetyloxyacetyl)amino]-2-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-4-acetyloxy-5-[(2-acetyloxyacetyl)amino]-2-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 101171937 |
| Molecular Formula | C28H35NO14S |
| Molecular Weight | 641.65 g/mol |
| Exact Mass | 641.18 |
| IUPAC Name | methyl (2R,4S,5R,6R)-4-acetyloxy-5-[(2-acetyloxyacetyl)amino]-2-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(Sc2ccccc2)C[C@H](OC(C)=O)[C@@H](NC(=O)COC(C)=O)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C28H35NO14S/c1-15(30)38-13-22(41-18(4)33)25(42-19(5)34)26-24(29-23(35)14-39-16(2)31)21(40-17(3)32)12-28(43-26,27(36)37-6)44-20-10-8-7-9-11-20/h7-11,21-22,24-26H,12-14H2,1-6H3,(H,29,35)/t21-,22+,24+,25+,26+,28+/m0/s1 |
| InChIKey | QCPNULREWMEXEY-JMNPVCETSA-N |
| XLogP | 0.84 |
| TPSA | 196.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.65 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|