C24H31NO11S — CID 100988212
methyl (2R,4S,5R,6R)-5-acetamido-4-acetyloxy-6-[(1S,2R)-2,3-diacetyloxy-1-hydroxypropyl]-2-phenylsulfanyloxane-2-carboxylate (PubChem CID 100988212) has the molecular formula C24H31NO11S and a molecular weight of 541.58 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-5-acetamido-4-acetyloxy-6-[(1S,2R)-2,3-diacetyloxy-1-hydroxypropyl]-2-phenylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-5-acetamido-4-acetyloxy-6-[(1S,2R)-2,3-diacetyloxy-1-hydroxypropyl]-2-phenylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 100988212 |
| Molecular Formula | C24H31NO11S |
| Molecular Weight | 541.58 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | methyl (2R,4S,5R,6R)-5-acetamido-4-acetyloxy-6-[(1S,2R)-2,3-diacetyloxy-1-hydroxypropyl]-2-phenylsulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(Sc2ccccc2)C[C@H](OC(C)=O)[C@@H](NC(C)=O)[C@H]([C@H](O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C24H31NO11S/c1-13(26)25-20-18(34-15(3)28)11-24(23(31)32-5,37-17-9-7-6-8-10-17)36-22(20)21(30)19(35-16(4)29)12-33-14(2)27/h6-10,18-22,30H,11-12H2,1-5H3,(H,25,26)/t18-,19+,20+,21+,22+,24+/m0/s1 |
| InChIKey | PUCFKPSLJQRFIO-KZXFCMPVSA-N |
| XLogP | 0.73 |
| TPSA | 163.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.58 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|