C21H26O10S — CID 101180163
methyl (2R,4R,5R,6R)-4,5-diacetyloxy-6-[(1R)-1-acetyloxy-2-hydroxyethyl]-2-phenylsulfanyloxane-2-carboxylate (PubChem CID 101180163) has the molecular formula C21H26O10S and a molecular weight of 470.50 g/mol. Its IUPAC name is methyl (2R,4R,5R,6R)-4,5-diacetyloxy-6-[(1R)-1-acetyloxy-2-hydroxyethyl]-2-phenylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (2R,4R,5R,6R)-4,5-diacetyloxy-6-[(1R)-1-acetyloxy-2-hydroxyethyl]-2-phenylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 101180163 |
| Molecular Formula | C21H26O10S |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | methyl (2R,4R,5R,6R)-4,5-diacetyloxy-6-[(1R)-1-acetyloxy-2-hydroxyethyl]-2-phenylsulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(Sc2ccccc2)C[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]([C@@H](CO)OC(C)=O)O1 |
| InChI | InChI=1S/C21H26O10S/c1-12(23)28-16-10-21(20(26)27-4,32-15-8-6-5-7-9-15)31-19(18(16)30-14(3)25)17(11-22)29-13(2)24/h5-9,16-19,22H,10-11H2,1-4H3/t16-,17-,18-,19-,21-/m1/s1 |
| InChIKey | GZXIHBXQTBVFJU-DRJBRKBZSA-N |
| XLogP | 1.22 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|