C40H37N3O11S — CID 101122344
methyl (2S,4S,5R,6R)-4-acetyloxy-5-azido-2-(4-methylphenyl)sulfanyl-6-[(1S,2R)-1,2,3-tribenzoyloxypropyl]oxane-2-carboxylate (PubChem CID 101122344) has the molecular formula C40H37N3O11S and a molecular weight of 767.81 g/mol. Its IUPAC name is methyl (2S,4S,5R,6R)-4-acetyloxy-5-azido-2-(4-methylphenyl)sulfanyl-6-[(1S,2R)-1,2,3-tribenzoyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,4S,5R,6R)-4-acetyloxy-5-azido-2-(4-methylphenyl)sulfanyl-6-[(1S,2R)-1,2,3-tribenzoyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 101122344 |
| Molecular Formula | C40H37N3O11S |
| Molecular Weight | 767.81 g/mol |
| Exact Mass | 767.21 |
| IUPAC Name | methyl (2S,4S,5R,6R)-4-acetyloxy-5-azido-2-(4-methylphenyl)sulfanyl-6-[(1S,2R)-1,2,3-tribenzoyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(Sc2ccc(C)cc2)C[C@H](OC(C)=O)[C@@H](N=[N+]=[N-])[C@H]([C@H](OC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)OC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C40H37N3O11S/c1-25-19-21-30(22-20-25)55-40(39(48)49-3)23-31(51-26(2)44)33(42-43-41)35(54-40)34(53-38(47)29-17-11-6-12-18-29)32(52-37(46)28-15-9-5-10-16-28)24-50-36(45)27-13-7-4-8-14-27/h4-22,31-35H,23-24H2,1-3H3/t31-,32+,33+,34+,35+,40-/m0/s1 |
| InChIKey | FYWAXRCMQIVOEJ-FWRHVKRUSA-N |
| XLogP | 6.66 |
| TPSA | 189.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.81 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|