C24H35N3O12 — CID 101362491
methyl (2R,4S,5R,6R)-4-acetyloxy-5-azido-2-cyclohexyloxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 101362491) has the molecular formula C24H35N3O12 and a molecular weight of 557.55 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-4-acetyloxy-5-azido-2-cyclohexyloxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-4-acetyloxy-5-azido-2-cyclohexyloxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 101362491 |
| Molecular Formula | C24H35N3O12 |
| Molecular Weight | 557.55 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | methyl (2R,4S,5R,6R)-4-acetyloxy-5-azido-2-cyclohexyloxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(OC2CCCCC2)C[C@H](OC(C)=O)[C@@H](N=[N+]=[N-])[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C24H35N3O12/c1-13(28)34-12-19(36-15(3)30)21(37-16(4)31)22-20(26-27-25)18(35-14(2)29)11-24(39-22,23(32)33-5)38-17-9-7-6-8-10-17/h17-22H,6-12H2,1-5H3/t18-,19+,20+,21+,22+,24+/m0/s1 |
| InChIKey | DWJXRSCNAGKQIS-KZXFCMPVSA-N |
| XLogP | 2.03 |
| TPSA | 198.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.55 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|