C17H24N4O6S — CID 164575030
methyl (2R,4S,5R,6R)-5-amino-6-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-2-(4-methylphenyl)sulfanyloxane-2-carboxylate (PubChem CID 164575030) has the molecular formula C17H24N4O6S and a molecular weight of 412.47 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-5-amino-6-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-2-(4-methylphenyl)sulfanyloxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-5-amino-6-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-2-(4-methylphenyl)sulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 164575030 |
| Molecular Formula | C17H24N4O6S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | methyl (2R,4S,5R,6R)-5-amino-6-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-2-(4-methylphenyl)sulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(Sc2ccc(C)cc2)C[C@H](O)[C@@H](N)[C@H]([C@H](O)[C@H](O)CN=[N+]=[N-])O1 |
| InChI | InChI=1S/C17H24N4O6S/c1-9-3-5-10(6-4-9)28-17(16(25)26-2)7-11(22)13(18)15(27-17)14(24)12(23)8-20-21-19/h3-6,11-15,22-24H,7-8,18H2,1-2H3/t11-,12+,13+,14+,15+,17+/m0/s1 |
| InChIKey | PESQOXBHTQXNSZ-WTUOYXTGSA-N |
| XLogP | 0.47 |
| TPSA | 171.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|