C22H32N4O8S — CID 176889551
methyl 6-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-2-(4-methylphenyl)sulfanyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-2-carboxylate (PubChem CID 176889551) has the molecular formula C22H32N4O8S and a molecular weight of 512.59 g/mol. Its IUPAC name is methyl 6-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-2-(4-methylphenyl)sulfanyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-2-carboxylate.
| Compound Name | methyl 6-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-2-(4-methylphenyl)sulfanyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-2-carboxylate |
|---|---|
| PubChem CID | 176889551 |
| Molecular Formula | C22H32N4O8S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | methyl 6-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-2-(4-methylphenyl)sulfanyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]oxane-2-carboxylate |
| SMILES | COC(=O)C1(Sc2ccc(C)cc2)CC(O)C(NC(=O)OC(C)(C)C)C([C@H](O)[C@H](O)CN=[N+]=[N-])O1 |
| InChI | InChI=1S/C22H32N4O8S/c1-12-6-8-13(9-7-12)35-22(19(30)32-5)10-14(27)16(25-20(31)34-21(2,3)4)18(33-22)17(29)15(28)11-24-26-23/h6-9,14-18,27-29H,10-11H2,1-5H3,(H,25,31)/t14?,15-,16?,17-,18?,22?/m1/s1 |
| InChIKey | FGTLEQIMPSEFAM-HJAROHDDSA-N |
| XLogP | 2.03 |
| TPSA | 183.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|