C19H28N2O8S — CID 164574955
methyl (2R,4S,5R,6R)-6-[(1R,2R)-3-amino-1,2-dihydroxypropyl]-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-(4-methylphenyl)sulfanyloxane-2-carboxylate (PubChem CID 164574955) has the molecular formula C19H28N2O8S and a molecular weight of 444.51 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-6-[(1R,2R)-3-amino-1,2-dihydroxypropyl]-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-(4-methylphenyl)sulfanyloxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-6-[(1R,2R)-3-amino-1,2-dihydroxypropyl]-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-(4-methylphenyl)sulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 164574955 |
| Molecular Formula | C19H28N2O8S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | methyl (2R,4S,5R,6R)-6-[(1R,2R)-3-amino-1,2-dihydroxypropyl]-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-(4-methylphenyl)sulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(Sc2ccc(C)cc2)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@H](O)CN)O1 |
| InChI | InChI=1S/C19H28N2O8S/c1-10-3-5-11(6-4-10)30-19(18(27)28-2)7-12(23)15(21-14(25)9-22)17(29-19)16(26)13(24)8-20/h3-6,12-13,15-17,22-24,26H,7-9,20H2,1-2H3,(H,21,25)/t12-,13+,15+,16+,17+,19+/m0/s1 |
| InChIKey | UWGZHLMPTDKKSS-YZKZVDITSA-N |
| XLogP | -1.74 |
| TPSA | 171.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |