C19H26N4O8S — CID 164575031
methyl (2R,4S,5R,6R)-6-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-(4-methylphenyl)sulfanyloxane-2-carboxylate (PubChem CID 164575031) has the molecular formula C19H26N4O8S and a molecular weight of 470.50 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-6-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-(4-methylphenyl)sulfanyloxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-6-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-(4-methylphenyl)sulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 164575031 |
| Molecular Formula | C19H26N4O8S |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | methyl (2R,4S,5R,6R)-6-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-(4-methylphenyl)sulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(Sc2ccc(C)cc2)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@H](O)CN=[N+]=[N-])O1 |
| InChI | InChI=1S/C19H26N4O8S/c1-10-3-5-11(6-4-10)32-19(18(29)30-2)7-12(25)15(22-14(27)9-24)17(31-19)16(28)13(26)8-21-23-20/h3-6,12-13,15-17,24-26,28H,7-9H2,1-2H3,(H,22,27)/t12-,13+,15+,16+,17+,19+/m0/s1 |
| InChIKey | RZIYEIDCWQXPNZ-YZKZVDITSA-N |
| XLogP | -0.38 |
| TPSA | 194.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|