C11H19N3O7 — CID 157128293
methyl (2R,4R,5R)-6-(3-azido-1,2-dihydroxypropyl)-2,4-dihydroxy-5-methyloxane-2-carboxylate (PubChem CID 157128293) has the molecular formula C11H19N3O7 and a molecular weight of 305.29 g/mol. Its IUPAC name is methyl (2R,4R,5R)-6-(3-azido-1,2-dihydroxypropyl)-2,4-dihydroxy-5-methyloxane-2-carboxylate.
| Compound Name | methyl (2R,4R,5R)-6-(3-azido-1,2-dihydroxypropyl)-2,4-dihydroxy-5-methyloxane-2-carboxylate |
|---|---|
| PubChem CID | 157128293 |
| Molecular Formula | C11H19N3O7 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | methyl (2R,4R,5R)-6-(3-azido-1,2-dihydroxypropyl)-2,4-dihydroxy-5-methyloxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(O)C[C@@H](O)[C@@H](C)C(C(O)C(O)CN=[N+]=[N-])O1 |
| InChI | InChI=1S/C11H19N3O7/c1-5-6(15)3-11(19,10(18)20-2)21-9(5)8(17)7(16)4-13-14-12/h5-9,15-17,19H,3-4H2,1-2H3/t5-,6-,7?,8?,9?,11-/m1/s1 |
| InChIKey | MTRXYIVMVUMPBQ-RHZCSYBZSA-N |
| XLogP | -1.33 |
| TPSA | 165.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|