C18H30N4O8 — CID 176889528
methyl 6-[(1S,2S)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enyloxane-2-carboxylate (PubChem CID 176889528) has the molecular formula C18H30N4O8 and a molecular weight of 430.46 g/mol. Its IUPAC name is methyl 6-[(1S,2S)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enyloxane-2-carboxylate.
| Compound Name | methyl 6-[(1S,2S)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enyloxane-2-carboxylate |
|---|---|
| PubChem CID | 176889528 |
| Molecular Formula | C18H30N4O8 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | methyl 6-[(1S,2S)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-prop-2-enyloxane-2-carboxylate |
| SMILES | C=CCC1(C(=O)OC)CC(O)C(NC(=O)OC(C)(C)C)C([C@@H](O)[C@@H](O)CN=[N+]=[N-])O1 |
| InChI | InChI=1S/C18H30N4O8/c1-6-7-18(15(26)28-5)8-10(23)12(21-16(27)30-17(2,3)4)14(29-18)13(25)11(24)9-20-22-19/h6,10-14,23-25H,1,7-9H2,2-5H3,(H,21,27)/t10?,11-,12?,13-,14?,18?/m0/s1 |
| InChIKey | INWLLEJXRNAWRQ-GNSZYRACSA-N |
| XLogP | 0.55 |
| TPSA | 183.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|