C15H24N4O8 — CID 102454089
methyl (2R,3R,4S)-2-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 102454089) has the molecular formula C15H24N4O8 and a molecular weight of 388.38 g/mol. Its IUPAC name is methyl (2R,3R,4S)-2-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,3R,4S)-2-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 102454089 |
| Molecular Formula | C15H24N4O8 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | methyl (2R,3R,4S)-2-[(1R,2R)-3-azido-1,2-dihydroxypropyl]-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=C[C@H](O)[C@@H](NC(=O)OC(C)(C)C)[C@H]([C@H](O)[C@H](O)CN=[N+]=[N-])O1 |
| InChI | InChI=1S/C15H24N4O8/c1-15(2,3)27-14(24)18-10-7(20)5-9(13(23)25-4)26-12(10)11(22)8(21)6-17-19-16/h5,7-8,10-12,20-22H,6H2,1-4H3,(H,18,24)/t7-,8+,10+,11+,12+/m0/s1 |
| InChIKey | FTZQWZSAUIQSMH-RULNCXCMSA-N |
| XLogP | -0.27 |
| TPSA | 183.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|