C16H27NO8 — CID 161098517
methyl (2R,3R,4R)-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 161098517) has the molecular formula C16H27NO8 and a molecular weight of 361.39 g/mol. Its IUPAC name is methyl (2R,3R,4R)-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,3R,4R)-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 161098517 |
| Molecular Formula | C16H27NO8 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | methyl (2R,3R,4R)-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=C[C@H](NC(=O)OC(C)(C)C)[C@@H](C)[C@H]([C@H](O)[C@H](O)CO)O1 |
| InChI | InChI=1S/C16H27NO8/c1-8-9(17-15(22)25-16(2,3)4)6-11(14(21)23-5)24-13(8)12(20)10(19)7-18/h6,8-10,12-13,18-20H,7H2,1-5H3,(H,17,22)/t8-,9+,10-,12-,13-/m1/s1 |
| InChIKey | ZCHIQJKPDDQQRI-IFHCSVGRSA-N |
| XLogP | -0.31 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |